C18H23N3O4S — CID 131918040
N-benzyl-4-(furan-2-carbonyl)-N-methyl-1,4-diazepane-1-sulfonamide (PubChem CID 131918040) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-benzyl-4-(furan-2-carbonyl)-N-methyl-1,4-diazepane-1-sulfonamide.
| Compound Name | N-benzyl-4-(furan-2-carbonyl)-N-methyl-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 131918040 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-benzyl-4-(furan-2-carbonyl)-N-methyl-1,4-diazepane-1-sulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)N1CCCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H23N3O4S/c1-19(15-16-7-3-2-4-8-16)26(23,24)21-11-6-10-20(12-13-21)18(22)17-9-5-14-25-17/h2-5,7-9,14H,6,10-13,15H2,1H3 |
| InChIKey | FYFRCZQLKPTBKT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |