C20H25N7O2 — CID 161222794
3-oxo-5-[3-[2-[2-(2-oxoimidazolidin-1-yl)ethylamino]pyrimidin-5-yl]phenyl]pentanimidamide (PubChem CID 161222794) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 3-oxo-5-[3-[2-[2-(2-oxoimidazolidin-1-yl)ethylamino]pyrimidin-5-yl]phenyl]pentanimidamide.
| Compound Name | 3-oxo-5-[3-[2-[2-(2-oxoimidazolidin-1-yl)ethylamino]pyrimidin-5-yl]phenyl]pentanimidamide |
|---|---|
| PubChem CID | 161222794 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 3-oxo-5-[3-[2-[2-(2-oxoimidazolidin-1-yl)ethylamino]pyrimidin-5-yl]phenyl]pentanimidamide |
| SMILES | [H]/N=C(\N)CC(=O)CCc1cccc(-c2cnc(NCCN3CCNC3=O)nc2)c1 |
| InChI | InChI=1S/C20H25N7O2/c21-18(22)11-17(28)5-4-14-2-1-3-15(10-14)16-12-25-19(26-13-16)23-6-8-27-9-7-24-20(27)29/h1-3,10,12-13H,4-9,11H2,(H3,21,22)(H,24,29)(H,23,25,26) |
| InChIKey | UXSWVVSCJYKUIB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|