C20H25N5O2 — CID 153085217
5-[3-[2-(1,4-oxazepan-4-yl)pyrimidin-5-yl]phenyl]-3-oxopentanimidamide (PubChem CID 153085217) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-[3-[2-(1,4-oxazepan-4-yl)pyrimidin-5-yl]phenyl]-3-oxopentanimidamide.
| Compound Name | 5-[3-[2-(1,4-oxazepan-4-yl)pyrimidin-5-yl]phenyl]-3-oxopentanimidamide |
|---|---|
| PubChem CID | 153085217 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 5-[3-[2-(1,4-oxazepan-4-yl)pyrimidin-5-yl]phenyl]-3-oxopentanimidamide |
| SMILES | [H]/N=C(\N)CC(=O)CCc1cccc(-c2cnc(N3CCCOCC3)nc2)c1 |
| InChI | InChI=1S/C20H25N5O2/c21-19(22)12-18(26)6-5-15-3-1-4-16(11-15)17-13-23-20(24-14-17)25-7-2-9-27-10-8-25/h1,3-4,11,13-14H,2,5-10,12H2,(H3,21,22) |
| InChIKey | VOBPFNWJFDVGMQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 105.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|