C20H25N3O3 — CID 67035861
ethyl 3-[[1-(5-amino-2-pyridinyl)piperidin-4-yl]oxymethyl]benzoate (PubChem CID 67035861) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is ethyl 3-[[1-(5-amino-2-pyridinyl)piperidin-4-yl]oxymethyl]benzoate.
| Compound Name | ethyl 3-[[1-(5-amino-2-pyridinyl)piperidin-4-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 67035861 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | ethyl 3-[[1-(5-amino-2-pyridinyl)piperidin-4-yl]oxymethyl]benzoate |
| SMILES | CCOC(=O)c1cccc(COC2CCN(c3ccc(N)cn3)CC2)c1 |
| InChI | InChI=1S/C20H25N3O3/c1-2-25-20(24)16-5-3-4-15(12-16)14-26-18-8-10-23(11-9-18)19-7-6-17(21)13-22-19/h3-7,12-13,18H,2,8-11,14,21H2,1H3 |
| InChIKey | YKTABKDWVLXAIS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |