C12H17ClN4 — CID 97159889
(1S,8aR)-N-(5-chloropyrimidin-2-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 97159889) has the molecular formula C12H17ClN4 and a molecular weight of 252.75 g/mol. Its IUPAC name is (1S,8aR)-N-(5-chloropyrimidin-2-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | (1S,8aR)-N-(5-chloropyrimidin-2-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 97159889 |
| Molecular Formula | C12H17ClN4 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (1S,8aR)-N-(5-chloropyrimidin-2-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | Clc1cnc(N[C@H]2CCN3CCCC[C@H]23)nc1 |
| InChI | InChI=1S/C12H17ClN4/c13-9-7-14-12(15-8-9)16-10-4-6-17-5-2-1-3-11(10)17/h7-8,10-11H,1-6H2,(H,14,15,16)/t10-,11+/m0/s1 |
| InChIKey | LMEGXQYSRKJHFF-WDEREUQCSA-N |
| XLogP | 2.17 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |