C17H20N2S — CID 71658114
4-[[(1S,2S)-2-anilinocyclopentyl]amino]benzenethiol (PubChem CID 71658114) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-anilinocyclopentyl]amino]benzenethiol.
| Compound Name | 4-[[(1S,2S)-2-anilinocyclopentyl]amino]benzenethiol |
|---|---|
| PubChem CID | 71658114 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-[[(1S,2S)-2-anilinocyclopentyl]amino]benzenethiol |
| SMILES | Sc1ccc(N[C@H]2CCC[C@@H]2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2S/c20-15-11-9-14(10-12-15)19-17-8-4-7-16(17)18-13-5-2-1-3-6-13/h1-3,5-6,9-12,16-20H,4,7-8H2/t16-,17-/m0/s1 |
| InChIKey | MIYWMWFPECLPMV-IRXDYDNUSA-N |
| XLogP | 4.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|