C16H16N2 — CID 43782745
N-(6-bicyclo[3.2.0]hept-3-enyl)quinolin-3-amine (PubChem CID 43782745) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is N-(6-bicyclo[3.2.0]hept-3-enyl)quinolin-3-amine.
| Compound Name | N-(6-bicyclo[3.2.0]hept-3-enyl)quinolin-3-amine |
|---|---|
| PubChem CID | 43782745 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-(6-bicyclo[3.2.0]hept-3-enyl)quinolin-3-amine |
| SMILES | C1=CC2C(C1)CC2Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C16H16N2/c1-2-7-15-12(4-1)8-13(10-17-15)18-16-9-11-5-3-6-14(11)16/h1-4,6-8,10-11,14,16,18H,5,9H2 |
| InChIKey | AMNKNEAZABZUSF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|