C15H19N3 — CID 79724815
4-N-quinolin-3-ylcyclohexane-1,4-diamine (PubChem CID 79724815) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-N-quinolin-3-ylcyclohexane-1,4-diamine.
| Compound Name | 4-N-quinolin-3-ylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79724815 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-N-quinolin-3-ylcyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2cnc3ccccc3c2)CC1 |
| InChI | InChI=1S/C15H19N3/c16-12-5-7-13(8-6-12)18-14-9-11-3-1-2-4-15(11)17-10-14/h1-4,9-10,12-13,18H,5-8,16H2 |
| InChIKey | AIDRRQBDYIXUEK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |