C10H12N2S — CID 79047218
N-(6-bicyclo[3.2.0]hept-3-enyl)-1,3-thiazol-2-amine (PubChem CID 79047218) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is N-(6-bicyclo[3.2.0]hept-3-enyl)-1,3-thiazol-2-amine.
| Compound Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79047218 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-1,3-thiazol-2-amine |
| SMILES | C1=CC2C(C1)CC2Nc1nccs1 |
| InChI | InChI=1S/C10H12N2S/c1-2-7-6-9(8(7)3-1)12-10-11-4-5-13-10/h1,3-5,7-9H,2,6H2,(H,11,12) |
| InChIKey | XLWXXFQGAWVCJV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|