C13H22N2S — CID 4711973
N-dec-1-en-4-yl-1,3-thiazol-2-amine (PubChem CID 4711973) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is N-dec-1-en-4-yl-1,3-thiazol-2-amine.
| Compound Name | N-dec-1-en-4-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4711973 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-dec-1-en-4-yl-1,3-thiazol-2-amine |
| SMILES | C=CCC(CCCCCC)Nc1nccs1 |
| InChI | InChI=1S/C13H22N2S/c1-3-5-6-7-9-12(8-4-2)15-13-14-10-11-16-13/h4,10-12H,2-3,5-9H2,1H3,(H,14,15) |
| InChIKey | KEYBRPLNESFWBD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|