C11H19NOS — CID 10943825
1-(1,3-thiazol-2-yl)octan-1-ol (PubChem CID 10943825) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)octan-1-ol.
| Compound Name | 1-(1,3-thiazol-2-yl)octan-1-ol |
|---|---|
| PubChem CID | 10943825 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)octan-1-ol |
| SMILES | CCCCCCCC(O)c1nccs1 |
| InChI | InChI=1S/C11H19NOS/c1-2-3-4-5-6-7-10(13)11-12-8-9-14-11/h8-10,13H,2-7H2,1H3 |
| InChIKey | FSWKTMPBPFFGFM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|