C20H29NO2S — CID 67115711
5-(4-hexoxyphenyl)-5-(1,3-thiazol-2-yl)pentan-1-ol (PubChem CID 67115711) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is 5-(4-hexoxyphenyl)-5-(1,3-thiazol-2-yl)pentan-1-ol.
| Compound Name | 5-(4-hexoxyphenyl)-5-(1,3-thiazol-2-yl)pentan-1-ol |
|---|---|
| PubChem CID | 67115711 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 5-(4-hexoxyphenyl)-5-(1,3-thiazol-2-yl)pentan-1-ol |
| SMILES | CCCCCCOc1ccc(C(CCCCO)c2nccs2)cc1 |
| InChI | InChI=1S/C20H29NO2S/c1-2-3-4-7-15-23-18-11-9-17(10-12-18)19(8-5-6-14-22)20-21-13-16-24-20/h9-13,16,19,22H,2-8,14-15H2,1H3 |
| InChIKey | LIFPWHSKCXJLBZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|