C11H16N4S2 — CID 597966
1-N,1-N'-bis(1,3-thiazol-2-yl)pentane-1,1-diamine (PubChem CID 597966) has the molecular formula C11H16N4S2 and a molecular weight of 268.41 g/mol. Its IUPAC name is 1-N,1-N'-bis(1,3-thiazol-2-yl)pentane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(1,3-thiazol-2-yl)pentane-1,1-diamine |
|---|---|
| PubChem CID | 597966 |
| Molecular Formula | C11H16N4S2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-N,1-N'-bis(1,3-thiazol-2-yl)pentane-1,1-diamine |
| SMILES | CCCCC(Nc1nccs1)Nc1nccs1 |
| InChI | InChI=1S/C11H16N4S2/c1-2-3-4-9(14-10-12-5-7-16-10)15-11-13-6-8-17-11/h5-9H,2-4H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | DKMYOFXKPZXEJR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|