C13H21N3O2S — CID 3116902
N-(2-ethylhexyl)-N'-(1,3-thiazol-2-yl)oxamide (PubChem CID 3116902) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-(2-ethylhexyl)-N'-(1,3-thiazol-2-yl)oxamide.
| Compound Name | N-(2-ethylhexyl)-N'-(1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 3116902 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(2-ethylhexyl)-N'-(1,3-thiazol-2-yl)oxamide |
| SMILES | CCCCC(CC)CNC(=O)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C13H21N3O2S/c1-3-5-6-10(4-2)9-15-11(17)12(18)16-13-14-7-8-19-13/h7-8,10H,3-6,9H2,1-2H3,(H,15,17)(H,14,16,18) |
| InChIKey | YSSHYLMZHQUAKD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|