C14H23N3O3 — CID 47205589
N-(2-ethylhexyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 47205589) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(2-ethylhexyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N-(2-ethylhexyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 47205589 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-(2-ethylhexyl)-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | CCCCC(CC)CNC(=O)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C14H23N3O3/c1-4-6-7-11(5-2)9-15-13(18)14(19)16-12-8-10(3)20-17-12/h8,11H,4-7,9H2,1-3H3,(H,15,18)(H,16,17,19) |
| InChIKey | ACTXTUSQQICQIO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|