C12H13FN2 — CID 116812930
N-(6-bicyclo[3.2.0]hept-3-enyl)-6-fluoropyridin-2-amine (PubChem CID 116812930) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is N-(6-bicyclo[3.2.0]hept-3-enyl)-6-fluoropyridin-2-amine.
| Compound Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 116812930 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-6-fluoropyridin-2-amine |
| SMILES | Fc1cccc(NC2CC3CC=CC32)n1 |
| InChI | InChI=1S/C12H13FN2/c13-11-5-2-6-12(15-11)14-10-7-8-3-1-4-9(8)10/h1-2,4-6,8-10H,3,7H2,(H,14,15) |
| InChIKey | DMWFGAMGUPMCFA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|