C12H15FN2O — CID 103864006
N-(2-cyclopropyloxolan-3-yl)-6-fluoropyridin-2-amine (PubChem CID 103864006) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is N-(2-cyclopropyloxolan-3-yl)-6-fluoropyridin-2-amine.
| Compound Name | N-(2-cyclopropyloxolan-3-yl)-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 103864006 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-(2-cyclopropyloxolan-3-yl)-6-fluoropyridin-2-amine |
| SMILES | Fc1cccc(NC2CCOC2C2CC2)n1 |
| InChI | InChI=1S/C12H15FN2O/c13-10-2-1-3-11(15-10)14-9-6-7-16-12(9)8-4-5-8/h1-3,8-9,12H,4-7H2,(H,14,15) |
| InChIKey | JBTLMPTZYZHBNW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|