C17H19FN2 — CID 116813035
6-fluoro-N-(2-phenylcyclohexyl)pyridin-2-amine (PubChem CID 116813035) has the molecular formula C17H19FN2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 6-fluoro-N-(2-phenylcyclohexyl)pyridin-2-amine.
| Compound Name | 6-fluoro-N-(2-phenylcyclohexyl)pyridin-2-amine |
|---|---|
| PubChem CID | 116813035 |
| Molecular Formula | C17H19FN2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 6-fluoro-N-(2-phenylcyclohexyl)pyridin-2-amine |
| SMILES | Fc1cccc(NC2CCCCC2c2ccccc2)n1 |
| InChI | InChI=1S/C17H19FN2/c18-16-11-6-12-17(20-16)19-15-10-5-4-9-14(15)13-7-2-1-3-8-13/h1-3,6-8,11-12,14-15H,4-5,9-10H2,(H,19,20) |
| InChIKey | MOAZHSOUUHJKOO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|