C16H25N — CID 159407891
trans-(1R,2S)-N-tert-butyl-2-phenylcyclohexan-1-amine (PubChem CID 159407891) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is trans-(1R,2S)-N-tert-butyl-2-phenylcyclohexan-1-amine.
| Compound Name | trans-(1R,2S)-N-tert-butyl-2-phenylcyclohexan-1-amine |
|---|---|
| PubChem CID | 159407891 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | trans-(1R,2S)-N-tert-butyl-2-phenylcyclohexan-1-amine |
| SMILES | CC(C)(C)N[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H25N/c1-16(2,3)17-15-12-8-7-11-14(15)13-9-5-4-6-10-13/h4-6,9-10,14-15,17H,7-8,11-12H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | UVMSGMVSPSVPCU-LSDHHAIUSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |