C14H21N — CID 102179465
cis-(1S,2S)-N-tert-butyl-2-phenylcyclobutan-1-amine (PubChem CID 102179465) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is cis-(1S,2S)-N-tert-butyl-2-phenylcyclobutan-1-amine.
| Compound Name | cis-(1S,2S)-N-tert-butyl-2-phenylcyclobutan-1-amine |
|---|---|
| PubChem CID | 102179465 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | cis-(1S,2S)-N-tert-butyl-2-phenylcyclobutan-1-amine |
| SMILES | CC(C)(C)N[C@H]1CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H21N/c1-14(2,3)15-13-10-9-12(13)11-7-5-4-6-8-11/h4-8,12-13,15H,9-10H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | IANIJHNAFXDQLX-STQMWFEESA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |