C17H21NOS — CID 124861861
(2S)-1-[[(1S,2S)-2-phenylcyclobutyl]amino]-2-thiophen-2-ylpropan-2-ol (PubChem CID 124861861) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is (2S)-1-[[(1S,2S)-2-phenylcyclobutyl]amino]-2-thiophen-2-ylpropan-2-ol.
| Compound Name | (2S)-1-[[(1S,2S)-2-phenylcyclobutyl]amino]-2-thiophen-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 124861861 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (2S)-1-[[(1S,2S)-2-phenylcyclobutyl]amino]-2-thiophen-2-ylpropan-2-ol |
| SMILES | C[C@](O)(CN[C@H]1CC[C@H]1c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C17H21NOS/c1-17(19,16-8-5-11-20-16)12-18-15-10-9-14(15)13-6-3-2-4-7-13/h2-8,11,14-15,18-19H,9-10,12H2,1H3/t14-,15-,17-/m0/s1 |
| InChIKey | KBNUGDOXVNCZBK-ZOBUZTSGSA-N |
| XLogP | 3.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |