C36H58P2 — CID 135305318
ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-3,6-diphenylcyclohexyl]methyl]phosphane (PubChem CID 135305318) has the molecular formula C36H58P2 and a molecular weight of 552.81 g/mol. Its IUPAC name is ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-3,6-diphenylcyclohexyl]methyl]phosphane.
| Compound Name | ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-3,6-diphenylcyclohexyl]methyl]phosphane |
|---|---|
| PubChem CID | 135305318 |
| Molecular Formula | C36H58P2 |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.40 |
| IUPAC Name | ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-3,6-diphenylcyclohexyl]methyl]phosphane |
| SMILES | CC(C)(C)P(CC1C(c2ccccc2)CCC(c2ccccc2)C1CP(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H58P2/c1-33(2,3)37(34(4,5)6)25-31-29(27-19-15-13-16-20-27)23-24-30(28-21-17-14-18-22-28)32(31)26-38(35(7,8)9)36(10,11)12/h13-22,29-32H,23-26H2,1-12H3 |
| InChIKey | FCHTUMACJWTJMZ-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|