C32H42P2 — CID 137471998
ditert-butyl-[[2-(2-diphenylphosphanylphenyl)cyclopentyl]methyl]phosphane (PubChem CID 137471998) has the molecular formula C32H42P2 and a molecular weight of 488.64 g/mol. Its IUPAC name is ditert-butyl-[[2-(2-diphenylphosphanylphenyl)cyclopentyl]methyl]phosphane.
| Compound Name | ditert-butyl-[[2-(2-diphenylphosphanylphenyl)cyclopentyl]methyl]phosphane |
|---|---|
| PubChem CID | 137471998 |
| Molecular Formula | C32H42P2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | ditert-butyl-[[2-(2-diphenylphosphanylphenyl)cyclopentyl]methyl]phosphane |
| SMILES | CC(C)(C)P(CC1CCCC1c1ccccc1P(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H42P2/c1-31(2,3)33(32(4,5)6)24-25-16-15-22-28(25)29-21-13-14-23-30(29)34(26-17-9-7-10-18-26)27-19-11-8-12-20-27/h7-14,17-21,23,25,28H,15-16,22,24H2,1-6H3 |
| InChIKey | PAGQBSOGJIIUJM-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|