C35H32P2 — CID 101125838
[2-[(1S,2R)-2-diphenylphosphanylcyclopentyl]phenyl]-diphenylphosphane (PubChem CID 101125838) has the molecular formula C35H32P2 and a molecular weight of 514.59 g/mol. Its IUPAC name is [2-[(1S,2R)-2-diphenylphosphanylcyclopentyl]phenyl]-diphenylphosphane.
| Compound Name | [2-[(1S,2R)-2-diphenylphosphanylcyclopentyl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 101125838 |
| Molecular Formula | C35H32P2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | [2-[(1S,2R)-2-diphenylphosphanylcyclopentyl]phenyl]-diphenylphosphane |
| SMILES | c1ccc(P(c2ccccc2)c2ccccc2[C@@H]2CCC[C@H]2P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H32P2/c1-5-16-28(17-6-1)36(29-18-7-2-8-19-29)34-26-14-13-24-32(34)33-25-15-27-35(33)37(30-20-9-3-10-21-30)31-22-11-4-12-23-31/h1-14,16-24,26,33,35H,15,25,27H2/t33-,35+/m0/s1 |
| InChIKey | UACJSPIZMWRXQC-QWOOXDRHSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|