C30H30P2 — CID 59800266
[(1R,2R)-2-diphenylphosphanylcyclohexyl]-diphenylphosphane (PubChem CID 59800266) has the molecular formula C30H30P2 and a molecular weight of 452.52 g/mol. Its IUPAC name is [(1R,2R)-2-diphenylphosphanylcyclohexyl]-diphenylphosphane.
| Compound Name | [(1R,2R)-2-diphenylphosphanylcyclohexyl]-diphenylphosphane |
|---|---|
| PubChem CID | 59800266 |
| Molecular Formula | C30H30P2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [(1R,2R)-2-diphenylphosphanylcyclohexyl]-diphenylphosphane |
| SMILES | c1ccc(P(c2ccccc2)[C@@H]2CCCC[C@H]2P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30P2/c1-5-15-25(16-6-1)31(26-17-7-2-8-18-26)29-23-13-14-24-30(29)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-12,15-22,29-30H,13-14,23-24H2/t29-,30-/m1/s1 |
| InChIKey | YLDJNDYRGPTCKV-LOYHVIPDSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|