C25H35P — CID 90737985
cyclopentane;diphenyl-(2-propan-2-ylcyclopentyl)phosphane (PubChem CID 90737985) has the molecular formula C25H35P and a molecular weight of 366.53 g/mol. Its IUPAC name is cyclopentane;diphenyl-(2-propan-2-ylcyclopentyl)phosphane.
| Compound Name | cyclopentane;diphenyl-(2-propan-2-ylcyclopentyl)phosphane |
|---|---|
| PubChem CID | 90737985 |
| Molecular Formula | C25H35P |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | cyclopentane;diphenyl-(2-propan-2-ylcyclopentyl)phosphane |
| SMILES | C1CCCC1.CC(C)C1CCCC1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25P.C5H10/c1-16(2)19-14-9-15-20(19)21(17-10-5-3-6-11-17)18-12-7-4-8-13-18;1-2-4-5-3-1/h3-8,10-13,16,19-20H,9,14-15H2,1-2H3;1-5H2 |
| InChIKey | FADVJGVQYAZDAJ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|