C22H29P — CID 2734569
[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-diphenylphosphane (PubChem CID 2734569) has the molecular formula C22H29P and a molecular weight of 324.45 g/mol. Its IUPAC name is [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-diphenylphosphane.
| Compound Name | [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-diphenylphosphane |
|---|---|
| PubChem CID | 2734569 |
| Molecular Formula | C22H29P |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-diphenylphosphane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29P/c1-17(2)21-15-14-18(3)16-22(21)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,17-18,21-22H,14-16H2,1-3H3/t18-,21+,22+/m1/s1 |
| InChIKey | BEYDOEXXFGNVRZ-COPCDDAFSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|