C26H43O3PS — CID 102219109
2-bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]phosphanylbenzenesulfonic acid (PubChem CID 102219109) has the molecular formula C26H43O3PS and a molecular weight of 466.67 g/mol. Its IUPAC name is 2-bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]phosphanylbenzenesulfonic acid.
| Compound Name | 2-bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]phosphanylbenzenesulfonic acid |
|---|---|
| PubChem CID | 102219109 |
| Molecular Formula | C26H43O3PS |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2-bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]phosphanylbenzenesulfonic acid |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1P(c1ccccc1S(=O)(=O)O)[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C26H43O3PS/c1-17(2)21-13-11-19(5)15-24(21)30(23-9-7-8-10-26(23)31(27,28)29)25-16-20(6)12-14-22(25)18(3)4/h7-10,17-22,24-25H,11-16H2,1-6H3,(H,27,28,29)/t19-,20-,21+,22+,24-,25-/m1/s1 |
| InChIKey | VNWOSVUJKCZLKW-XBMHUJOKSA-N |
| XLogP | 6.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|