C26H43Sn — CID 10096491
CID 10096491 (PubChem CID 10096491) has the molecular formula C26H43Sn and a molecular weight of 474.34 g/mol.
| Compound Name | CID 10096491 |
|---|---|
| PubChem CID | 10096491 |
| Molecular Formula | C26H43Sn |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | — |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1[Sn](c1ccccc1)[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/2C10H19.C6H5.Sn/c2*1-8(2)10-6-4-9(3)5-7-10;1-2-4-6-5-3-1;/h2*6,8-10H,4-5,7H2,1-3H3;1-5H;/t2*9-,10-;;/m00../s1 |
| InChIKey | KBZQZYJXHXCKQC-AXSBIKAKSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |