C30H51Sn — CID 10744805
CID 10744805 (PubChem CID 10744805) has the molecular formula C30H51Sn and a molecular weight of 530.45 g/mol.
| Compound Name | CID 10744805 |
|---|---|
| PubChem CID | 10744805 |
| Molecular Formula | C30H51Sn |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | — |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1[Sn](CC(C)(C)c1ccccc1)[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/2C10H19.C10H13.Sn/c2*1-8(2)10-6-4-9(3)5-7-10;1-10(2,3)9-7-5-4-6-8-9;/h2*6,8-10H,4-5,7H2,1-3H3;4-8H,1H2,2-3H3;/t2*9-,10-;;/m00../s1 |
| InChIKey | BTMFFOGWXYRZLF-AXSBIKAKSA-N |
| XLogP | 9.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |