C23H36 — CID 177410240
[(3R)-3,4-dimethyl-1-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]pent-1-en-3-yl]benzene (PubChem CID 177410240) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is [(3R)-3,4-dimethyl-1-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]pent-1-en-3-yl]benzene.
| Compound Name | [(3R)-3,4-dimethyl-1-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]pent-1-en-3-yl]benzene |
|---|---|
| PubChem CID | 177410240 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | [(3R)-3,4-dimethyl-1-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]pent-1-en-3-yl]benzene |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1C=C[C@](C)(c1ccccc1)C(C)C |
| InChI | InChI=1S/C23H36/c1-17(2)22-13-12-19(5)16-20(22)14-15-23(6,18(3)4)21-10-8-7-9-11-21/h7-11,14-15,17-20,22H,12-13,16H2,1-6H3/t19-,20-,22-,23+/m1/s1 |
| InChIKey | UQOVBFQRALYPAI-PRTQVNTJSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|