C21H32O — CID 101052478
(E,1R)-3-methyl-1-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-4-phenylbut-2-en-1-ol (PubChem CID 101052478) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (E,1R)-3-methyl-1-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-4-phenylbut-2-en-1-ol.
| Compound Name | (E,1R)-3-methyl-1-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-4-phenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 101052478 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (E,1R)-3-methyl-1-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-4-phenylbut-2-en-1-ol |
| SMILES | C/C(=C\[C@H](O)[C@@H]1C[C@H](C)CC[C@@H]1C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C21H32O/c1-15(2)19-11-10-16(3)13-20(19)21(22)14-17(4)12-18-8-6-5-7-9-18/h5-9,14-16,19-22H,10-13H2,1-4H3/b17-14+/t16-,19-,20-,21+/m1/s1 |
| InChIKey | MFBZAYMXVWUQSO-BRUGEDKQSA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|