C16H30O — CID 15984657
(E,1R)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hex-2-en-1-ol (PubChem CID 15984657) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (E,1R)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hex-2-en-1-ol.
| Compound Name | (E,1R)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hex-2-en-1-ol |
|---|---|
| PubChem CID | 15984657 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (E,1R)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]hex-2-en-1-ol |
| SMILES | CCC/C=C/[C@@H](O)[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C16H30O/c1-5-6-7-8-16(17)15-11-13(4)9-10-14(15)12(2)3/h7-8,12-17H,5-6,9-11H2,1-4H3/b8-7+/t13-,14+,15-,16-/m1/s1 |
| InChIKey | KVWMOBQWMIRUMQ-NUFFDZAISA-N |
| XLogP | 4.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|