C15H28O2 — CID 101174952
(E,1S)-3-methyl-1-(5-methyl-2-propan-2-ylcyclohexyl)but-2-ene-1,4-diol (PubChem CID 101174952) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (E,1S)-3-methyl-1-(5-methyl-2-propan-2-ylcyclohexyl)but-2-ene-1,4-diol.
| Compound Name | (E,1S)-3-methyl-1-(5-methyl-2-propan-2-ylcyclohexyl)but-2-ene-1,4-diol |
|---|---|
| PubChem CID | 101174952 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (E,1S)-3-methyl-1-(5-methyl-2-propan-2-ylcyclohexyl)but-2-ene-1,4-diol |
| SMILES | C/C(=C\[C@@H](O)C1CC(C)CCC1C(C)C)CO |
| InChI | InChI=1S/C15H28O2/c1-10(2)13-6-5-11(3)7-14(13)15(17)8-12(4)9-16/h8,10-11,13-17H,5-7,9H2,1-4H3/b12-8+/t11?,13?,14?,15-/m1/s1 |
| InChIKey | YHEGAODXYUUQRJ-QNYVUDMDSA-N |
| XLogP | 2.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|