C27H50O — CID 21245671
2,6-bis(5-methyl-2-propan-2-ylcyclohexyl)heptan-4-one (PubChem CID 21245671) has the molecular formula C27H50O and a molecular weight of 390.70 g/mol. Its IUPAC name is 2,6-bis(5-methyl-2-propan-2-ylcyclohexyl)heptan-4-one.
| Compound Name | 2,6-bis(5-methyl-2-propan-2-ylcyclohexyl)heptan-4-one |
|---|---|
| PubChem CID | 21245671 |
| Molecular Formula | C27H50O |
| Molecular Weight | 390.70 g/mol |
| Exact Mass | 390.39 |
| IUPAC Name | 2,6-bis(5-methyl-2-propan-2-ylcyclohexyl)heptan-4-one |
| SMILES | CC1CCC(C(C)C)C(C(C)CC(=O)CC(C)C2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/C27H50O/c1-17(2)24-11-9-19(5)13-26(24)21(7)15-23(28)16-22(8)27-14-20(6)10-12-25(27)18(3)4/h17-22,24-27H,9-16H2,1-8H3 |
| InChIKey | BFJBORAIXZMQKH-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.70 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |