C15H27O3- — CID 22599016
4-hydroxy-2-(5-methyl-2-propan-2-ylcyclohexyl)pentanoate (PubChem CID 22599016) has the molecular formula C15H27O3- and a molecular weight of 255.38 g/mol. Its IUPAC name is 4-hydroxy-2-(5-methyl-2-propan-2-ylcyclohexyl)pentanoate.
| Compound Name | 4-hydroxy-2-(5-methyl-2-propan-2-ylcyclohexyl)pentanoate |
|---|---|
| PubChem CID | 22599016 |
| Molecular Formula | C15H27O3- |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 4-hydroxy-2-(5-methyl-2-propan-2-ylcyclohexyl)pentanoate |
| SMILES | CC(O)CC(C(=O)[O-])C1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C15H28O3/c1-9(2)12-6-5-10(3)7-13(12)14(15(17)18)8-11(4)16/h9-14,16H,5-8H2,1-4H3,(H,17,18)/p-1 |
| InChIKey | LMFREMVGHSDMCU-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |