C21H38O — CID 42643545
(1S,2R,4R)-2-[(E,1S)-1-ethenoxy-3-methyloct-2-enyl]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 42643545) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is (1S,2R,4R)-2-[(E,1S)-1-ethenoxy-3-methyloct-2-enyl]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-[(E,1S)-1-ethenoxy-3-methyloct-2-enyl]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 42643545 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | (1S,2R,4R)-2-[(E,1S)-1-ethenoxy-3-methyloct-2-enyl]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | C=CO[C@H](/C=C(\C)CCCCC)[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C21H38O/c1-7-9-10-11-17(5)15-21(22-8-2)20-14-18(6)12-13-19(20)16(3)4/h8,15-16,18-21H,2,7,9-14H2,1,3-6H3/b17-15+/t18-,19+,20-,21-/m1/s1 |
| InChIKey | ZSFCMDZCUCZHAU-LQRIWFEESA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|