About sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate
sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 175453818) has the molecular formula C22H41NaO3
and a molecular weight of 376.56 g/mol. Its IUPAC name is sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate |
| PubChem CID | 175453818 |
| Molecular Formula | C22H41NaO3 |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCCC(=O)OC(=O)C1CC(C)CCC1C(C)C.[H-].[Na+] |
| InChI | InChI=1S/C22H40O3.Na.H/c1-5-6-7-8-9-10-11-12-13-21(23)25-22(24)20-16-18(4)14-15-19(20)17(2)3;;/h17-20H,5-16H2,1-4H3;;/q;+1;-1 |
| InChIKey | RCGHKHBYROVXKJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate?
The IUPAC name of sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate (CID 175453818) is sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate.
What is the SMILES notation for sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate?
The canonical SMILES for sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate is CCCCCCCCCCC(=O)OC(=O)C1CC(C)CCC1C(C)C.[H-].[Na+].
What is the InChIKey of sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate?
The InChIKey is RCGHKHBYROVXKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40O3.Na.H/c1-5-6-7-8-9-10-11-12-13-21(23)25-22(24)20-16-18(4)14-15-19(20)17(2)3;;/h17-20H,5-16H2,1-4H3;;/q;+1;-1.
What are the key properties of sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate?
sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate has a molecular weight of 376.56 g/mol, XLogP of 3.41, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;undecanoyl 5-methyl-2-propan-2-ylcyclohexane-1-carboxylate is sourced from PubChem (CID 175453818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).