C18H30O2 — CID 166527115
hept-6-yn-2-yl (1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 166527115) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is hept-6-yn-2-yl (1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate.
| Compound Name | hept-6-yn-2-yl (1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 166527115 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | hept-6-yn-2-yl (1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | C#CCCCC(C)OC(=O)[C@H]1C[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C18H30O2/c1-6-7-8-9-15(5)20-18(19)17-12-14(4)10-11-16(17)13(2)3/h1,13-17H,7-12H2,2-5H3/t14-,15?,16+,17-/m0/s1 |
| InChIKey | CEJSPLASMJRGIF-CYBCNJLJSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|