C19H26O3 — CID 73053416
phenacyl (1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 73053416) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is phenacyl (1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate.
| Compound Name | phenacyl (1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 73053416 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | phenacyl (1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@@H]1C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26O3/c1-13(2)16-10-9-14(3)11-17(16)19(21)22-12-18(20)15-7-5-4-6-8-15/h4-8,13-14,16-17H,9-12H2,1-3H3/t14-,16-,17+/m1/s1 |
| InChIKey | GLMLWXVVTHMVII-OIISXLGYSA-N |
| XLogP | 4.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |