C19H28O — CID 101174954
(E,1S)-1-(5-methyl-2-propan-2-ylcyclohexyl)-3-phenylprop-2-en-1-ol (PubChem CID 101174954) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (E,1S)-1-(5-methyl-2-propan-2-ylcyclohexyl)-3-phenylprop-2-en-1-ol.
| Compound Name | (E,1S)-1-(5-methyl-2-propan-2-ylcyclohexyl)-3-phenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 101174954 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (E,1S)-1-(5-methyl-2-propan-2-ylcyclohexyl)-3-phenylprop-2-en-1-ol |
| SMILES | CC1CCC(C(C)C)C([C@@H](O)/C=C/c2ccccc2)C1 |
| InChI | InChI=1S/C19H28O/c1-14(2)17-11-9-15(3)13-18(17)19(20)12-10-16-7-5-4-6-8-16/h4-8,10,12,14-15,17-20H,9,11,13H2,1-3H3/b12-10+/t15?,17?,18?,19-/m0/s1 |
| InChIKey | AHIJGSKEYFHDJU-HVECLQSKSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |