C27H34O2 — CID 102405534
[(1Z,3E)-2-methoxy-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-phenylbuta-1,3-dienyl]benzene (PubChem CID 102405534) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is [(1Z,3E)-2-methoxy-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-phenylbuta-1,3-dienyl]benzene.
| Compound Name | [(1Z,3E)-2-methoxy-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-phenylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 102405534 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [(1Z,3E)-2-methoxy-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-phenylbuta-1,3-dienyl]benzene |
| SMILES | COC(/C=C/c1ccccc1)=C(\O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H34O2/c1-20(2)24-17-15-21(3)19-26(24)29-27(23-13-9-6-10-14-23)25(28-4)18-16-22-11-7-5-8-12-22/h5-14,16,18,20-21,24,26H,15,17,19H2,1-4H3/b18-16+,27-25-/t21-,24+,26-/m1/s1 |
| InChIKey | IAXKWHAZWMLXAY-UDGXKFEUSA-N |
| XLogP | 7.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|