C24H34O3 — CID 10832983
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methyl-2-[(E)-3-phenylprop-2-enoxy]but-2-enoate (PubChem CID 10832983) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methyl-2-[(E)-3-phenylprop-2-enoxy]but-2-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methyl-2-[(E)-3-phenylprop-2-enoxy]but-2-enoate |
|---|---|
| PubChem CID | 10832983 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methyl-2-[(E)-3-phenylprop-2-enoxy]but-2-enoate |
| SMILES | CC(C)=C(OC/C=C/c1ccccc1)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C24H34O3/c1-17(2)21-14-13-19(5)16-22(21)27-24(25)23(18(3)4)26-15-9-12-20-10-7-6-8-11-20/h6-12,17,19,21-22H,13-16H2,1-5H3/b12-9+/t19-,21+,22-/m1/s1 |
| InChIKey | TXHKRQZYFFWRFC-UGVPMQKVSA-N |
| XLogP | 6.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|