C12H14O2 — CID 10797753
(E,1R)-1-[(2R,3R)-3-methyloxiran-2-yl]-3-phenylprop-2-en-1-ol (PubChem CID 10797753) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (E,1R)-1-[(2R,3R)-3-methyloxiran-2-yl]-3-phenylprop-2-en-1-ol.
| Compound Name | (E,1R)-1-[(2R,3R)-3-methyloxiran-2-yl]-3-phenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 10797753 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (E,1R)-1-[(2R,3R)-3-methyloxiran-2-yl]-3-phenylprop-2-en-1-ol |
| SMILES | C[C@H]1O[C@@H]1[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H14O2/c1-9-12(14-9)11(13)8-7-10-5-3-2-4-6-10/h2-9,11-13H,1H3/b8-7+/t9-,11-,12+/m1/s1 |
| InChIKey | ZCFQZBBZOYWJCQ-NNZAVJKRSA-N |
| XLogP | 1.85 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|