C13H12O3 — CID 102159683
(2S)-2-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]-2H-furan-5-one (PubChem CID 102159683) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is (2S)-2-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]-2H-furan-5-one.
| Compound Name | (2S)-2-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 102159683 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (2S)-2-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]-2H-furan-5-one |
| SMILES | O=C1C=C[C@@H]([C@@H](O)/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C13H12O3/c14-11(12-8-9-13(15)16-12)7-6-10-4-2-1-3-5-10/h1-9,11-12,14H/b7-6+/t11-,12-/m0/s1 |
| InChIKey | GKFWACHUTQEREG-KZQRZKTQSA-N |
| XLogP | 1.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |