C19H24O6 — CID 127030351
(2S,3S)-3-hydroxy-2-[(E,2R,4R,6S)-2,4,6-trihydroxy-8-phenyloct-7-enyl]-2,3-dihydropyran-6-one (PubChem CID 127030351) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2-[(E,2R,4R,6S)-2,4,6-trihydroxy-8-phenyloct-7-enyl]-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-3-hydroxy-2-[(E,2R,4R,6S)-2,4,6-trihydroxy-8-phenyloct-7-enyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 127030351 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (2S,3S)-3-hydroxy-2-[(E,2R,4R,6S)-2,4,6-trihydroxy-8-phenyloct-7-enyl]-2,3-dihydropyran-6-one |
| SMILES | O=C1C=C[C@H](O)[C@H](C[C@H](O)C[C@@H](O)C[C@H](O)/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C19H24O6/c20-14(7-6-13-4-2-1-3-5-13)10-15(21)11-16(22)12-18-17(23)8-9-19(24)25-18/h1-9,14-18,20-23H,10-12H2/b7-6+/t14-,15+,16-,17+,18+/m1/s1 |
| InChIKey | JYRNWDFSBDZJDV-HSMJIBECSA-N |
| XLogP | 0.80 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |