C22H20O6 — CID 102191998
[(1S,2R,3R)-2,3-dihydroxy-3-[(2R)-5-oxo-2H-furan-2-yl]-1-phenylpropyl] (E)-3-phenylprop-2-enoate (PubChem CID 102191998) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is [(1S,2R,3R)-2,3-dihydroxy-3-[(2R)-5-oxo-2H-furan-2-yl]-1-phenylpropyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1S,2R,3R)-2,3-dihydroxy-3-[(2R)-5-oxo-2H-furan-2-yl]-1-phenylpropyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 102191998 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [(1S,2R,3R)-2,3-dihydroxy-3-[(2R)-5-oxo-2H-furan-2-yl]-1-phenylpropyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C1C=C[C@H]([C@H](O)[C@@H](O)[C@@H](OC(=O)/C=C/c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C22H20O6/c23-18-14-12-17(27-18)20(25)21(26)22(16-9-5-2-6-10-16)28-19(24)13-11-15-7-3-1-4-8-15/h1-14,17,20-22,25-26H/b13-11+/t17-,20+,21-,22+/m1/s1 |
| InChIKey | WLLDFHYKLHQFIW-LRIPSDHDSA-N |
| XLogP | 2.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|