C22H18O5 — CID 5318092
[(3S)-6-oxo-2-[(2S,3R)-3-phenyloxiran-2-yl]-2,3-dihydropyran-3-yl] (E)-3-phenylprop-2-enoate (PubChem CID 5318092) has the molecular formula C22H18O5 and a molecular weight of 362.38 g/mol. Its IUPAC name is [(3S)-6-oxo-2-[(2S,3R)-3-phenyloxiran-2-yl]-2,3-dihydropyran-3-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(3S)-6-oxo-2-[(2S,3R)-3-phenyloxiran-2-yl]-2,3-dihydropyran-3-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 5318092 |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [(3S)-6-oxo-2-[(2S,3R)-3-phenyloxiran-2-yl]-2,3-dihydropyran-3-yl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C1C=C[C@H](OC(=O)/C=C/c2ccccc2)C([C@H]2O[C@@H]2c2ccccc2)O1 |
| InChI | InChI=1S/C22H18O5/c23-18(13-11-15-7-3-1-4-8-15)25-17-12-14-19(24)26-21(17)22-20(27-22)16-9-5-2-6-10-16/h1-14,17,20-22H/b13-11+/t17-,20+,21?,22-/m0/s1 |
| InChIKey | SXDWURVOACIILU-RBYLRQTCSA-N |
| XLogP | 3.23 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|