C13H12O4 — CID 51415619
(2S,3R,3aR,7aS)-3-hydroxy-2-phenyl-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-5-one (PubChem CID 51415619) has the molecular formula C13H12O4 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2S,3R,3aR,7aS)-3-hydroxy-2-phenyl-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-5-one.
| Compound Name | (2S,3R,3aR,7aS)-3-hydroxy-2-phenyl-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-5-one |
|---|---|
| PubChem CID | 51415619 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (2S,3R,3aR,7aS)-3-hydroxy-2-phenyl-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-5-one |
| SMILES | O=C1C=C[C@@H]2O[C@@H](c3ccccc3)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C13H12O4/c14-10-7-6-9-13(17-10)11(15)12(16-9)8-4-2-1-3-5-8/h1-7,9,11-13,15H/t9-,11+,12-,13-/m0/s1 |
| InChIKey | ZKIRVBNLJKGIEM-RYDUCSDGSA-N |
| XLogP | 0.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |