C21H22O8 — CID 162885470
[(3S,4R)-1-[(2S,3R,3aR,7aR)-3-hydroxy-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-2-yl]-4-acetyloxypent-1-en-3-yl] benzoate (PubChem CID 162885470) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is [(3S,4R)-1-[(2S,3R,3aR,7aR)-3-hydroxy-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-2-yl]-4-acetyloxypent-1-en-3-yl] benzoate.
| Compound Name | [(3S,4R)-1-[(2S,3R,3aR,7aR)-3-hydroxy-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-2-yl]-4-acetyloxypent-1-en-3-yl] benzoate |
|---|---|
| PubChem CID | 162885470 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [(3S,4R)-1-[(2S,3R,3aR,7aR)-3-hydroxy-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-2-yl]-4-acetyloxypent-1-en-3-yl] benzoate |
| SMILES | CC(=O)O[C@H](C)[C@H](C=C[C@@H]1O[C@@H]2C=CC(=O)O[C@@H]2[C@@H]1O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22O8/c1-12(26-13(2)22)15(28-21(25)14-6-4-3-5-7-14)8-9-16-19(24)20-17(27-16)10-11-18(23)29-20/h3-12,15-17,19-20,24H,1-2H3/t12-,15+,16+,17-,19-,20+/m1/s1 |
| InChIKey | BROQQOMLEPNYFH-ZQHKCTDPSA-N |
| XLogP | 1.33 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|